Insecticide Pesticide Pyriproxyfen 95% TC
Description: An insecticide used to control public health insect pests. Also used for flea control on domestic pets.
Example pests controlled: Flies; Mosquitoes; Midges; Ants; Cockroaches; Whiteflies
Example applications: Waste dumps; Residences and public places; Some ornamentals
Chemical structure:
| Isomerism | A molecules with one chiral centre. The technical material is an isomeric mixture. |
| Chemical formula | C20H19NO3 |
| Canonical SMILES | CC(COC1=CC=C(C=C1)OC2=CC=CC=C2)OC3=CC=CC=N3 |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | NHDHVHZZCFYRSB-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C20H19NO3/c1-16(23-20-9-5-6-14-21-20)15-22-17-10-12-19(13-11-17)24-18-7-3-2-4-8-18/h2-14,16H,15H2,1H3 |
General status:
| Pesticide type | Insecticide, Veterinary substance |
| Substance group | Unclassified |
| Minimum active substance purity | 970 g/kg racemic mixture |
| Known relevant impurities | EU dossier - toluene 5g/kg |
| Substance origin | Synthetic |
| Mode of action | A juvenile hormone mimic. Inhibits insect maturation process |
| CAS RN | 95737-68-1 |
| EC number | 429-800-1 |
| CIPAC number | 715 |
| US EPA chemical code | 129032 |
| PubChem CID | 91753 |
| Molecular mass (g mol-1) | 321.37 |
| PIN (Preferred Identification Name) | - |
| IUPAC name | 4-phenoxyphenyl (RS)-2-(2-pyridyloxy)propyl ether |
| CAS name | 2-(1-methyl-2-(4-phenoxyphenoxy)ethoxy)pyridine |
